C15H22N4O2 — CID 128726839
(4aS,8aS)-6-(4-tert-butylpyrimidin-2-yl)-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 128726839) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is (4aS,8aS)-6-(4-tert-butylpyrimidin-2-yl)-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | (4aS,8aS)-6-(4-tert-butylpyrimidin-2-yl)-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 128726839 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (4aS,8aS)-6-(4-tert-butylpyrimidin-2-yl)-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | CC(C)(C)c1ccnc(N2CC[C@@H]3OCC(=O)N[C@H]3C2)n1 |
| InChI | InChI=1S/C15H22N4O2/c1-15(2,3)12-4-6-16-14(18-12)19-7-5-11-10(8-19)17-13(20)9-21-11/h4,6,10-11H,5,7-9H2,1-3H3,(H,17,20)/t10-,11-/m0/s1 |
| InChIKey | JGKBYPWDKBZNKS-QWRGUYRKSA-N |
| XLogP | 0.87 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |