C20H23BF3N5O3 — CID 170785060
CID 170785060 (PubChem CID 170785060) has the molecular formula C20H23BF3N5O3 and a molecular weight of 449.24 g/mol.
| Compound Name | CID 170785060 |
|---|---|
| PubChem CID | 170785060 |
| Molecular Formula | C20H23BF3N5O3 |
| Molecular Weight | 449.24 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | — |
| SMILES | [B][C@@]12CN(C(=O)N3CC4(CC(Cc5ccnc(C(F)(F)F)n5)C4)C3)CC[C@@H]1OCC(=O)N2 |
| InChI | InChI=1S/C20H23BF3N5O3/c21-19-11-28(4-2-14(19)32-8-15(30)27-19)17(31)29-9-18(10-29)6-12(7-18)5-13-1-3-25-16(26-13)20(22,23)24/h1,3,12,14H,2,4-11H2,(H,27,30)/t14-,19+/m0/s1 |
| InChIKey | RTSZTDIZNWXVBM-IFXJQAMLSA-N |
| XLogP | 0.96 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|