C20H18O4S — CID 12872915
dimethyl 5,5-diphenyl-2H-thiophene-3,4-dicarboxylate (PubChem CID 12872915) has the molecular formula C20H18O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is dimethyl 5,5-diphenyl-2H-thiophene-3,4-dicarboxylate.
| Compound Name | dimethyl 5,5-diphenyl-2H-thiophene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 12872915 |
| Molecular Formula | C20H18O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | dimethyl 5,5-diphenyl-2H-thiophene-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(c2ccccc2)(c2ccccc2)SC1 |
| InChI | InChI=1S/C20H18O4S/c1-23-18(21)16-13-25-20(17(16)19(22)24-2,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,13H2,1-2H3 |
| InChIKey | GRMPHMYIRYECJA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |