C12H12ClN3O3S — CID 12873201
N-[(E)-(4-chlorophenyl)methylideneamino]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 12873201) has the molecular formula C12H12ClN3O3S and a molecular weight of 313.77 g/mol. Its IUPAC name is N-[(E)-(4-chlorophenyl)methylideneamino]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[(E)-(4-chlorophenyl)methylideneamino]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 12873201 |
| Molecular Formula | C12H12ClN3O3S |
| Molecular Weight | 313.77 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | N-[(E)-(4-chlorophenyl)methylideneamino]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)N/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H12ClN3O3S/c1-8-12(9(2)19-15-8)20(17,18)16-14-7-10-3-5-11(13)6-4-10/h3-7,16H,1-2H3/b14-7+ |
| InChIKey | OAJHEUBBUUESAO-VGOFMYFVSA-N |
| XLogP | 2.26 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.77 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|