C12H16N6O2S — CID 128743141
1-[2-(5-amino-1,3,4-oxadiazol-2-yl)ethyl]-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)urea (PubChem CID 128743141) has the molecular formula C12H16N6O2S and a molecular weight of 308.37 g/mol. Its IUPAC name is 1-[2-(5-amino-1,3,4-oxadiazol-2-yl)ethyl]-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-[2-(5-amino-1,3,4-oxadiazol-2-yl)ethyl]-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 128743141 |
| Molecular Formula | C12H16N6O2S |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-[2-(5-amino-1,3,4-oxadiazol-2-yl)ethyl]-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)urea |
| SMILES | Nc1nnc(CCNC(=O)Nc2nc3c(s2)CCCC3)o1 |
| InChI | InChI=1S/C12H16N6O2S/c13-10-18-17-9(20-10)5-6-14-11(19)16-12-15-7-3-1-2-4-8(7)21-12/h1-6H2,(H2,13,18)(H2,14,15,16,19) |
| InChIKey | TVFLKHRRTFZHMJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |