C12H19N3OS — CID 128753845
1-(4-methylthiophen-3-yl)-3-(piperidin-3-ylmethyl)urea (PubChem CID 128753845) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 1-(4-methylthiophen-3-yl)-3-(piperidin-3-ylmethyl)urea.
| Compound Name | 1-(4-methylthiophen-3-yl)-3-(piperidin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 128753845 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1-(4-methylthiophen-3-yl)-3-(piperidin-3-ylmethyl)urea |
| SMILES | Cc1cscc1NC(=O)NCC1CCCNC1 |
| InChI | InChI=1S/C12H19N3OS/c1-9-7-17-8-11(9)15-12(16)14-6-10-3-2-4-13-5-10/h7-8,10,13H,2-6H2,1H3,(H2,14,15,16) |
| InChIKey | SVZUFDYSGYTPOT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |