C14H22F3N5O — CID 128758056
1-(azepan-4-yl)-3-[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]-1-methylurea (PubChem CID 128758056) has the molecular formula C14H22F3N5O and a molecular weight of 333.36 g/mol. Its IUPAC name is 1-(azepan-4-yl)-3-[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]-1-methylurea.
| Compound Name | 1-(azepan-4-yl)-3-[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]-1-methylurea |
|---|---|
| PubChem CID | 128758056 |
| Molecular Formula | C14H22F3N5O |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 1-(azepan-4-yl)-3-[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]-1-methylurea |
| SMILES | CCn1ncc(NC(=O)N(C)C2CCCNCC2)c1C(F)(F)F |
| InChI | InChI=1S/C14H22F3N5O/c1-3-22-12(14(15,16)17)11(9-19-22)20-13(23)21(2)10-5-4-7-18-8-6-10/h9-10,18H,3-8H2,1-2H3,(H,20,23) |
| InChIKey | HNCYNBBXGPATCC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |