C17H25F3N4O — CID 164638754
1-[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]-3-[(4S)-spiro[4.5]decan-4-yl]urea (PubChem CID 164638754) has the molecular formula C17H25F3N4O and a molecular weight of 358.41 g/mol. Its IUPAC name is 1-[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]-3-[(4S)-spiro[4.5]decan-4-yl]urea.
| Compound Name | 1-[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]-3-[(4S)-spiro[4.5]decan-4-yl]urea |
|---|---|
| PubChem CID | 164638754 |
| Molecular Formula | C17H25F3N4O |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 1-[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]-3-[(4S)-spiro[4.5]decan-4-yl]urea |
| SMILES | CCn1ncc(NC(=O)N[C@H]2CCCC23CCCCC3)c1C(F)(F)F |
| InChI | InChI=1S/C17H25F3N4O/c1-2-24-14(17(18,19)20)12(11-21-24)22-15(25)23-13-7-6-10-16(13)8-4-3-5-9-16/h11,13H,2-10H2,1H3,(H2,22,23,25)/t13-/m0/s1 |
| InChIKey | SKXNWRKSHPRXPV-ZDUSSCGKSA-N |
| XLogP | 4.55 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |