C17H26F3N5O — CID 128758059
N-[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]-2-piperidin-3-ylpiperidine-1-carboxamide (PubChem CID 128758059) has the molecular formula C17H26F3N5O and a molecular weight of 373.42 g/mol. Its IUPAC name is N-[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]-2-piperidin-3-ylpiperidine-1-carboxamide.
| Compound Name | N-[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]-2-piperidin-3-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 128758059 |
| Molecular Formula | C17H26F3N5O |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | N-[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]-2-piperidin-3-ylpiperidine-1-carboxamide |
| SMILES | CCn1ncc(NC(=O)N2CCCCC2C2CCCNC2)c1C(F)(F)F |
| InChI | InChI=1S/C17H26F3N5O/c1-2-25-15(17(18,19)20)13(11-22-25)23-16(26)24-9-4-3-7-14(24)12-6-5-8-21-10-12/h11-12,14,21H,2-10H2,1H3,(H,23,26) |
| InChIKey | PYIIUAVFNPVIBF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |