C15H23ClN4O2 — CID 128781624
N-[(4-chloro-1-methylpyrazol-3-yl)methyl]-4-cyclobutyloxypiperidine-1-carboxamide (PubChem CID 128781624) has the molecular formula C15H23ClN4O2 and a molecular weight of 326.83 g/mol. Its IUPAC name is N-[(4-chloro-1-methylpyrazol-3-yl)methyl]-4-cyclobutyloxypiperidine-1-carboxamide.
| Compound Name | N-[(4-chloro-1-methylpyrazol-3-yl)methyl]-4-cyclobutyloxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 128781624 |
| Molecular Formula | C15H23ClN4O2 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N-[(4-chloro-1-methylpyrazol-3-yl)methyl]-4-cyclobutyloxypiperidine-1-carboxamide |
| SMILES | Cn1cc(Cl)c(CNC(=O)N2CCC(OC3CCC3)CC2)n1 |
| InChI | InChI=1S/C15H23ClN4O2/c1-19-10-13(16)14(18-19)9-17-15(21)20-7-5-12(6-8-20)22-11-3-2-4-11/h10-12H,2-9H2,1H3,(H,17,21) |
| InChIKey | QOHPFJUBPUSZLQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |