C7H9Cl2N3O — CID 131071456
2-chloro-N-[(4-chloro-1-methylpyrazol-3-yl)methyl]acetamide (PubChem CID 131071456) has the molecular formula C7H9Cl2N3O and a molecular weight of 222.07 g/mol. Its IUPAC name is 2-chloro-N-[(4-chloro-1-methylpyrazol-3-yl)methyl]acetamide.
| Compound Name | 2-chloro-N-[(4-chloro-1-methylpyrazol-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 131071456 |
| Molecular Formula | C7H9Cl2N3O |
| Molecular Weight | 222.07 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | 2-chloro-N-[(4-chloro-1-methylpyrazol-3-yl)methyl]acetamide |
| SMILES | Cn1cc(Cl)c(CNC(=O)CCl)n1 |
| InChI | InChI=1S/C7H9Cl2N3O/c1-12-4-5(9)6(11-12)3-10-7(13)2-8/h4H,2-3H2,1H3,(H,10,13) |
| InChIKey | HDULSKBEBWGDDO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.07 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|