C17H30N4O3S — CID 128808178
N-[2-(cyclohepten-1-yl)ethyl]-3-piperazin-1-ylsulfonylazetidine-1-carboxamide (PubChem CID 128808178) has the molecular formula C17H30N4O3S and a molecular weight of 370.52 g/mol. Its IUPAC name is N-[2-(cyclohepten-1-yl)ethyl]-3-piperazin-1-ylsulfonylazetidine-1-carboxamide.
| Compound Name | N-[2-(cyclohepten-1-yl)ethyl]-3-piperazin-1-ylsulfonylazetidine-1-carboxamide |
|---|---|
| PubChem CID | 128808178 |
| Molecular Formula | C17H30N4O3S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-[2-(cyclohepten-1-yl)ethyl]-3-piperazin-1-ylsulfonylazetidine-1-carboxamide |
| SMILES | O=C(NCCC1=CCCCCC1)N1CC(S(=O)(=O)N2CCNCC2)C1 |
| InChI | InChI=1S/C17H30N4O3S/c22-17(19-8-7-15-5-3-1-2-4-6-15)20-13-16(14-20)25(23,24)21-11-9-18-10-12-21/h5,16,18H,1-4,6-14H2,(H,19,22) |
| InChIKey | WWBHYOPVRFHNAD-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|