C13H23NO — CID 12883327
(2S,4R)-2-methyl-4-[(E)-prop-1-enyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-ol (PubChem CID 12883327) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (2S,4R)-2-methyl-4-[(E)-prop-1-enyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-ol.
| Compound Name | (2S,4R)-2-methyl-4-[(E)-prop-1-enyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-ol |
|---|---|
| PubChem CID | 12883327 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (2S,4R)-2-methyl-4-[(E)-prop-1-enyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-ol |
| SMILES | C/C=C/[C@]1(O)C[C@H](C)NC2CCCCC21 |
| InChI | InChI=1S/C13H23NO/c1-3-8-13(15)9-10(2)14-12-7-5-4-6-11(12)13/h3,8,10-12,14-15H,4-7,9H2,1-2H3/b8-3+/t10-,11?,12?,13-/m0/s1 |
| InChIKey | GTDNFZNKNRVCHZ-XZRXHFPVSA-N |
| XLogP | 2.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|