C15H25N3O2 — CID 128840497
(5S)-5-[(2S)-butan-2-yl]-3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)imidazolidine-2,4-dione (PubChem CID 128840497) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is (5S)-5-[(2S)-butan-2-yl]-3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(2S)-butan-2-yl]-3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 128840497 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | (5S)-5-[(2S)-butan-2-yl]-3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)imidazolidine-2,4-dione |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)N(C2CC3CCC(C2)N3C)C1=O |
| InChI | InChI=1S/C15H25N3O2/c1-4-9(2)13-14(19)18(15(20)16-13)12-7-10-5-6-11(8-12)17(10)3/h9-13H,4-8H2,1-3H3,(H,16,20)/t9-,10?,11?,12?,13-/m0/s1 |
| InChIKey | XYMYSLJUCHSHMF-SGNUNNOASA-N |
| XLogP | 1.58 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|