About 3-butan-2-yl-1-(1-methylpiperidin-4-yl)-1,4-diazepane-2,5-dione
3-butan-2-yl-1-(1-methylpiperidin-4-yl)-1,4-diazepane-2,5-dione (PubChem CID 64960078) has the molecular formula C15H27N3O2
and a molecular weight of 281.40 g/mol. Its IUPAC name is 3-butan-2-yl-1-(1-methylpiperidin-4-yl)-1,4-diazepane-2,5-dione.
Molecular Properties
| Compound Name | 3-butan-2-yl-1-(1-methylpiperidin-4-yl)-1,4-diazepane-2,5-dione |
| PubChem CID | 64960078 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 3-butan-2-yl-1-(1-methylpiperidin-4-yl)-1,4-diazepane-2,5-dione |
| SMILES | CCC(C)C1NC(=O)CCN(C2CCN(C)CC2)C1=O |
| InChI | InChI=1S/C15H27N3O2/c1-4-11(2)14-15(20)18(10-7-13(19)16-14)12-5-8-17(3)9-6-12/h11-12,14H,4-10H2,1-3H3,(H,16,19) |
| InChIKey | USORKISGODUTKB-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-butan-2-yl-1-(1-methylpiperidin-4-yl)-1,4-diazepane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yl-1-(1-methylpiperidin-4-yl)-1,4-diazepane-2,5-dione?
The IUPAC name of 3-butan-2-yl-1-(1-methylpiperidin-4-yl)-1,4-diazepane-2,5-dione (CID 64960078) is 3-butan-2-yl-1-(1-methylpiperidin-4-yl)-1,4-diazepane-2,5-dione.
What is the SMILES notation for 3-butan-2-yl-1-(1-methylpiperidin-4-yl)-1,4-diazepane-2,5-dione?
The canonical SMILES for 3-butan-2-yl-1-(1-methylpiperidin-4-yl)-1,4-diazepane-2,5-dione is CCC(C)C1NC(=O)CCN(C2CCN(C)CC2)C1=O.
What is the InChIKey of 3-butan-2-yl-1-(1-methylpiperidin-4-yl)-1,4-diazepane-2,5-dione?
The InChIKey is USORKISGODUTKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3O2/c1-4-11(2)14-15(20)18(10-7-13(19)16-14)12-5-8-17(3)9-6-12/h11-12,14H,4-10H2,1-3H3,(H,16,19).
What are the key properties of 3-butan-2-yl-1-(1-methylpiperidin-4-yl)-1,4-diazepane-2,5-dione?
3-butan-2-yl-1-(1-methylpiperidin-4-yl)-1,4-diazepane-2,5-dione has a molecular weight of 281.40 g/mol, XLogP of 0.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-1-(1-methylpiperidin-4-yl)-1,4-diazepane-2,5-dione is sourced from PubChem (CID 64960078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).