C17H20N4O2S — CID 128859088
N-(4,4-dimethyl-5,6-dihydrocyclopenta[d][1,3]thiazol-2-yl)-8-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxamide (PubChem CID 128859088) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is N-(4,4-dimethyl-5,6-dihydrocyclopenta[d][1,3]thiazol-2-yl)-8-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxamide.
| Compound Name | N-(4,4-dimethyl-5,6-dihydrocyclopenta[d][1,3]thiazol-2-yl)-8-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 128859088 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-(4,4-dimethyl-5,6-dihydrocyclopenta[d][1,3]thiazol-2-yl)-8-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carboxamide |
| SMILES | CC1(C)CCc2sc(NC(=O)N3CCc4cc[nH]c(=O)c4C3)nc21 |
| InChI | InChI=1S/C17H20N4O2S/c1-17(2)6-3-12-13(17)19-15(24-12)20-16(23)21-8-5-10-4-7-18-14(22)11(10)9-21/h4,7H,3,5-6,8-9H2,1-2H3,(H,18,22)(H,19,20,23) |
| InChIKey | QTNNLMXQCIWACA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |