C19H19N3O3 — CID 166422239
N-[[2-(8-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carbonyl)phenyl]methyl]prop-2-enamide (PubChem CID 166422239) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-[[2-(8-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carbonyl)phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[2-(8-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carbonyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 166422239 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-[[2-(8-oxo-1,3,4,7-tetrahydro-2,7-naphthyridine-2-carbonyl)phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1ccccc1C(=O)N1CCc2cc[nH]c(=O)c2C1 |
| InChI | InChI=1S/C19H19N3O3/c1-2-17(23)21-11-14-5-3-4-6-15(14)19(25)22-10-8-13-7-9-20-18(24)16(13)12-22/h2-7,9H,1,8,10-12H2,(H,20,24)(H,21,23) |
| InChIKey | RMLGZTAGENMSOX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|