C25H25BrN2O6 — CID 1288805
(5R)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(3-bromophenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 1288805) has the molecular formula C25H25BrN2O6 and a molecular weight of 529.39 g/mol. Its IUPAC name is (5R)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(3-bromophenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(3-bromophenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 1288805 |
| Molecular Formula | C25H25BrN2O6 |
| Molecular Weight | 529.39 g/mol |
| Exact Mass | 528.09 |
| IUPAC Name | (5R)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(3-bromophenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCCN2CCOCC2)[C@H](c2cccc(Br)c2)C1=C(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H25BrN2O6/c26-18-4-1-3-16(13-18)22-21(23(29)17-5-6-19-20(14-17)34-15-33-19)24(30)25(31)28(22)8-2-7-27-9-11-32-12-10-27/h1,3-6,13-14,22,29H,2,7-12,15H2/t22-/m1/s1 |
| InChIKey | QKINQYHHSLTVCJ-JOCHJYFZSA-N |
| XLogP | 3.32 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|