C25H25N3O8 — CID 4863975
4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 4863975) has the molecular formula C25H25N3O8 and a molecular weight of 495.49 g/mol. Its IUPAC name is 4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4863975 |
| Molecular Formula | C25H25N3O8 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCCN2CCOCC2)C(c2cccc([N+](=O)[O-])c2)C1=C(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H25N3O8/c29-23(17-5-6-19-20(14-17)36-15-35-19)21-22(16-3-1-4-18(13-16)28(32)33)27(25(31)24(21)30)8-2-7-26-9-11-34-12-10-26/h1,3-6,13-14,22,29H,2,7-12,15H2 |
| InChIKey | NRWMQVRYXNYTGH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|