C13H22N4O2 — CID 128888612
1-[(1R,3S)-3-cyanocyclopentyl]-3-(1,4-oxazepan-2-ylmethyl)urea (PubChem CID 128888612) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-[(1R,3S)-3-cyanocyclopentyl]-3-(1,4-oxazepan-2-ylmethyl)urea.
| Compound Name | 1-[(1R,3S)-3-cyanocyclopentyl]-3-(1,4-oxazepan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 128888612 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 1-[(1R,3S)-3-cyanocyclopentyl]-3-(1,4-oxazepan-2-ylmethyl)urea |
| SMILES | N#C[C@H]1CC[C@@H](NC(=O)NCC2CNCCCO2)C1 |
| InChI | InChI=1S/C13H22N4O2/c14-7-10-2-3-11(6-10)17-13(18)16-9-12-8-15-4-1-5-19-12/h10-12,15H,1-6,8-9H2,(H2,16,17,18)/t10-,11+,12?/m0/s1 |
| InChIKey | DRPZSSZDDWAKDH-WIKAKEFZSA-N |
| XLogP | 0.36 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |