C13H26N4O2 — CID 128834356
2,3-dimethyl-N-(1,4-oxazepan-2-ylmethyl)piperazine-1-carboxamide (PubChem CID 128834356) has the molecular formula C13H26N4O2 and a molecular weight of 270.38 g/mol. Its IUPAC name is 2,3-dimethyl-N-(1,4-oxazepan-2-ylmethyl)piperazine-1-carboxamide.
| Compound Name | 2,3-dimethyl-N-(1,4-oxazepan-2-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 128834356 |
| Molecular Formula | C13H26N4O2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 2,3-dimethyl-N-(1,4-oxazepan-2-ylmethyl)piperazine-1-carboxamide |
| SMILES | CC1NCCN(C(=O)NCC2CNCCCO2)C1C |
| InChI | InChI=1S/C13H26N4O2/c1-10-11(2)17(6-5-15-10)13(18)16-9-12-8-14-4-3-7-19-12/h10-12,14-15H,3-9H2,1-2H3,(H,16,18) |
| InChIKey | DFEMGRQAMUUCNL-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |