C19H19ClN4O — CID 128903538
[4-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]-(3-chloro-4-pyridinyl)methanone (PubChem CID 128903538) has the molecular formula C19H19ClN4O and a molecular weight of 354.84 g/mol. Its IUPAC name is [4-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]-(3-chloro-4-pyridinyl)methanone.
| Compound Name | [4-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]-(3-chloro-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 128903538 |
| Molecular Formula | C19H19ClN4O |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [4-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]-(3-chloro-4-pyridinyl)methanone |
| SMILES | O=C(c1ccncc1Cl)N1CCC(Cc2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C19H19ClN4O/c20-15-12-21-8-5-14(15)19(25)24-9-6-13(7-10-24)11-18-22-16-3-1-2-4-17(16)23-18/h1-5,8,12-13H,6-7,9-11H2,(H,22,23) |
| InChIKey | IDXFCANTPJKPHT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |