C27H27N3O8 — CID 1289182
(2S)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(3-morpholin-4-ylpropyl)-2-(4-nitrophenyl)-2H-pyrrol-5-one (PubChem CID 1289182) has the molecular formula C27H27N3O8 and a molecular weight of 521.53 g/mol. Its IUPAC name is (2S)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(3-morpholin-4-ylpropyl)-2-(4-nitrophenyl)-2H-pyrrol-5-one.
| Compound Name | (2S)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(3-morpholin-4-ylpropyl)-2-(4-nitrophenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 1289182 |
| Molecular Formula | C27H27N3O8 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | (2S)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(3-morpholin-4-ylpropyl)-2-(4-nitrophenyl)-2H-pyrrol-5-one |
| SMILES | COc1cccc2cc(C(=O)C3=C(O)C(=O)N(CCCN4CCOCC4)[C@H]3c3ccc([N+](=O)[O-])cc3)oc12 |
| InChI | InChI=1S/C27H27N3O8/c1-36-20-5-2-4-18-16-21(38-26(18)20)24(31)22-23(17-6-8-19(9-7-17)30(34)35)29(27(33)25(22)32)11-3-10-28-12-14-37-15-13-28/h2,4-9,16,23,32H,3,10-15H2,1H3/t23-/m0/s1 |
| InChIKey | MWIBUYOFBJINGY-QHCPKHFHSA-N |
| XLogP | 3.65 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|