C24H22ClNO6 — CID 4866268
2-(4-chlorophenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(3-methoxypropyl)-2H-pyrrol-5-one (PubChem CID 4866268) has the molecular formula C24H22ClNO6 and a molecular weight of 455.89 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(3-methoxypropyl)-2H-pyrrol-5-one.
| Compound Name | 2-(4-chlorophenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(3-methoxypropyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4866268 |
| Molecular Formula | C24H22ClNO6 |
| Molecular Weight | 455.89 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 2-(4-chlorophenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(3-methoxypropyl)-2H-pyrrol-5-one |
| SMILES | COCCCN1C(=O)C(O)=C(C(=O)c2cc3cccc(OC)c3o2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22ClNO6/c1-30-12-4-11-26-20(14-7-9-16(25)10-8-14)19(22(28)24(26)29)21(27)18-13-15-5-3-6-17(31-2)23(15)32-18/h3,5-10,13,20,28H,4,11-12H2,1-2H3 |
| InChIKey | BBKUINLLJUPGNT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.89 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|