C27H29NO7 — CID 4866241
2-(4-butoxyphenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(2-methoxyethyl)-2H-pyrrol-5-one (PubChem CID 4866241) has the molecular formula C27H29NO7 and a molecular weight of 479.53 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(2-methoxyethyl)-2H-pyrrol-5-one.
| Compound Name | 2-(4-butoxyphenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(2-methoxyethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4866241 |
| Molecular Formula | C27H29NO7 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 2-(4-butoxyphenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(2-methoxyethyl)-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccc(C2C(C(=O)c3cc4cccc(OC)c4o3)=C(O)C(=O)N2CCOC)cc1 |
| InChI | InChI=1S/C27H29NO7/c1-4-5-14-34-19-11-9-17(10-12-19)23-22(25(30)27(31)28(23)13-15-32-2)24(29)21-16-18-7-6-8-20(33-3)26(18)35-21/h6-12,16,23,30H,4-5,13-15H2,1-3H3 |
| InChIKey | RHHFTYPCIVZJBU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|