C33H33NO6 — CID 4730149
1-benzyl-2-(4-hexoxyphenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 4730149) has the molecular formula C33H33NO6 and a molecular weight of 539.63 g/mol. Its IUPAC name is 1-benzyl-2-(4-hexoxyphenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 1-benzyl-2-(4-hexoxyphenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4730149 |
| Molecular Formula | C33H33NO6 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | 1-benzyl-2-(4-hexoxyphenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | CCCCCCOc1ccc(C2C(C(=O)c3cc4cccc(OC)c4o3)=C(O)C(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C33H33NO6/c1-3-4-5-9-19-39-25-17-15-23(16-18-25)29-28(31(36)33(37)34(29)21-22-11-7-6-8-12-22)30(35)27-20-24-13-10-14-26(38-2)32(24)40-27/h6-8,10-18,20,29,36H,3-5,9,19,21H2,1-2H3 |
| InChIKey | SSEJHSOPYANAKU-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|