C27H24N2O6S — CID 5241307
2-(4-butoxyphenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(1,3-thiazol-2-yl)-2H-pyrrol-5-one (PubChem CID 5241307) has the molecular formula C27H24N2O6S and a molecular weight of 504.56 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(1,3-thiazol-2-yl)-2H-pyrrol-5-one.
| Compound Name | 2-(4-butoxyphenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(1,3-thiazol-2-yl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 5241307 |
| Molecular Formula | C27H24N2O6S |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 2-(4-butoxyphenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(1,3-thiazol-2-yl)-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccc(C2C(C(=O)c3cc4cccc(OC)c4o3)=C(O)C(=O)N2c2nccs2)cc1 |
| InChI | InChI=1S/C27H24N2O6S/c1-3-4-13-34-18-10-8-16(9-11-18)22-21(24(31)26(32)29(22)27-28-12-14-36-27)23(30)20-15-17-6-5-7-19(33-2)25(17)35-20/h5-12,14-15,22,31H,3-4,13H2,1-2H3 |
| InChIKey | LTKVBDGQSXHALU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|