C28H31NO6 — CID 108585842
4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(4-pentoxyphenyl)-1-propyl-2H-pyrrol-5-one (PubChem CID 108585842) has the molecular formula C28H31NO6 and a molecular weight of 477.56 g/mol. Its IUPAC name is 4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(4-pentoxyphenyl)-1-propyl-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(4-pentoxyphenyl)-1-propyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108585842 |
| Molecular Formula | C28H31NO6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(4-pentoxyphenyl)-1-propyl-2H-pyrrol-5-one |
| SMILES | CCCCCOc1ccc(C2C(C(=O)c3cc4cccc(OC)c4o3)=C(O)C(=O)N2CCC)cc1 |
| InChI | InChI=1S/C28H31NO6/c1-4-6-7-16-34-20-13-11-18(12-14-20)24-23(26(31)28(32)29(24)15-5-2)25(30)22-17-19-9-8-10-21(33-3)27(19)35-22/h8-14,17,24,31H,4-7,15-16H2,1-3H3 |
| InChIKey | GOFQKQJKSODWAM-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|