C32H27ClN2O6S — CID 4864602
1-(6-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(4-pentoxyphenyl)-2H-pyrrol-5-one (PubChem CID 4864602) has the molecular formula C32H27ClN2O6S and a molecular weight of 603.10 g/mol. Its IUPAC name is 1-(6-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(4-pentoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 1-(6-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(4-pentoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4864602 |
| Molecular Formula | C32H27ClN2O6S |
| Molecular Weight | 603.10 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | 1-(6-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-2-(4-pentoxyphenyl)-2H-pyrrol-5-one |
| SMILES | CCCCCOc1ccc(C2C(C(=O)c3cc4cccc(OC)c4o3)=C(O)C(=O)N2c2nc3ccc(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C32H27ClN2O6S/c1-3-4-5-15-40-21-12-9-18(10-13-21)27-26(28(36)24-16-19-7-6-8-23(39-2)30(19)41-24)29(37)31(38)35(27)32-34-22-14-11-20(33)17-25(22)42-32/h6-14,16-17,27,37H,3-5,15H2,1-2H3 |
| InChIKey | NZMBQYVZQLMBOG-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.10 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|