C26H27NO8 — CID 4866278
2-(3,4-dimethoxyphenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(3-methoxypropyl)-2H-pyrrol-5-one (PubChem CID 4866278) has the molecular formula C26H27NO8 and a molecular weight of 481.50 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(3-methoxypropyl)-2H-pyrrol-5-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(3-methoxypropyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4866278 |
| Molecular Formula | C26H27NO8 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4-hydroxy-3-(7-methoxy-1-benzofuran-2-carbonyl)-1-(3-methoxypropyl)-2H-pyrrol-5-one |
| SMILES | COCCCN1C(=O)C(O)=C(C(=O)c2cc3cccc(OC)c3o2)C1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H27NO8/c1-31-12-6-11-27-22(15-9-10-17(32-2)19(13-15)34-4)21(24(29)26(27)30)23(28)20-14-16-7-5-8-18(33-3)25(16)35-20/h5,7-10,13-14,22,29H,6,11-12H2,1-4H3 |
| InChIKey | XWJZFJIHCFJJPW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|