C9H8ClN3S — CID 12894742
4-[(4-chlorophenyl)methylsulfanyl]-2H-triazole (PubChem CID 12894742) has the molecular formula C9H8ClN3S and a molecular weight of 225.70 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methylsulfanyl]-2H-triazole.
| Compound Name | 4-[(4-chlorophenyl)methylsulfanyl]-2H-triazole |
|---|---|
| PubChem CID | 12894742 |
| Molecular Formula | C9H8ClN3S |
| Molecular Weight | 225.70 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 4-[(4-chlorophenyl)methylsulfanyl]-2H-triazole |
| SMILES | Clc1ccc(CSc2cn[nH]n2)cc1 |
| InChI | InChI=1S/C9H8ClN3S/c10-8-3-1-7(2-4-8)6-14-9-5-11-13-12-9/h1-5H,6H2,(H,11,12,13) |
| InChIKey | YLJKUOQENGVRBT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.70 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |