C20H28N2O4S — CID 128950643
N-[4-[1-(2-bicyclo[2.2.1]heptanyl)ethylsulfamoyl]phenyl]oxolane-3-carboxamide (PubChem CID 128950643) has the molecular formula C20H28N2O4S and a molecular weight of 392.52 g/mol. Its IUPAC name is N-[4-[1-(2-bicyclo[2.2.1]heptanyl)ethylsulfamoyl]phenyl]oxolane-3-carboxamide.
| Compound Name | N-[4-[1-(2-bicyclo[2.2.1]heptanyl)ethylsulfamoyl]phenyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 128950643 |
| Molecular Formula | C20H28N2O4S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-[4-[1-(2-bicyclo[2.2.1]heptanyl)ethylsulfamoyl]phenyl]oxolane-3-carboxamide |
| SMILES | CC(NS(=O)(=O)c1ccc(NC(=O)C2CCOC2)cc1)C1CC2CCC1C2 |
| InChI | InChI=1S/C20H28N2O4S/c1-13(19-11-14-2-3-15(19)10-14)22-27(24,25)18-6-4-17(5-7-18)21-20(23)16-8-9-26-12-16/h4-7,13-16,19,22H,2-3,8-12H2,1H3,(H,21,23) |
| InChIKey | NHISSACUWCMSBA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |