C21H22ClN3O3S2 — CID 128963577
1-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-3-pyrrol-1-yl-3-thiophen-3-ylpropan-1-one (PubChem CID 128963577) has the molecular formula C21H22ClN3O3S2 and a molecular weight of 464.01 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-3-pyrrol-1-yl-3-thiophen-3-ylpropan-1-one.
| Compound Name | 1-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-3-pyrrol-1-yl-3-thiophen-3-ylpropan-1-one |
|---|---|
| PubChem CID | 128963577 |
| Molecular Formula | C21H22ClN3O3S2 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 1-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-3-pyrrol-1-yl-3-thiophen-3-ylpropan-1-one |
| SMILES | O=C(CC(c1ccsc1)n1cccc1)N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H22ClN3O3S2/c22-18-3-5-19(6-4-18)30(27,28)25-12-10-24(11-13-25)21(26)15-20(17-7-14-29-16-17)23-8-1-2-9-23/h1-9,14,16,20H,10-13,15H2 |
| InChIKey | YOBHAILENKCTLN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |