C15H17N5O5S — CID 128965596
3-methyl-N-[[(2R,5S)-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]-[1,2]oxazolo[5,4-b]pyridine-5-sulfonamide (PubChem CID 128965596) has the molecular formula C15H17N5O5S and a molecular weight of 379.40 g/mol. Its IUPAC name is 3-methyl-N-[[(2R,5S)-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]-[1,2]oxazolo[5,4-b]pyridine-5-sulfonamide.
| Compound Name | 3-methyl-N-[[(2R,5S)-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]-[1,2]oxazolo[5,4-b]pyridine-5-sulfonamide |
|---|---|
| PubChem CID | 128965596 |
| Molecular Formula | C15H17N5O5S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 3-methyl-N-[[(2R,5S)-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]-[1,2]oxazolo[5,4-b]pyridine-5-sulfonamide |
| SMILES | Cc1noc([C@@H]2CC[C@H](CNS(=O)(=O)c3cnc4onc(C)c4c3)O2)n1 |
| InChI | InChI=1S/C15H17N5O5S/c1-8-12-5-11(7-16-14(12)24-19-8)26(21,22)17-6-10-3-4-13(23-10)15-18-9(2)20-25-15/h5,7,10,13,17H,3-4,6H2,1-2H3/t10-,13+/m1/s1 |
| InChIKey | PVWRRERVIZCGQW-MFKMUULPSA-N |
| XLogP | 1.42 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |