C14H14N4O3S — CID 86815657
N-[(3-aminophenyl)methyl]-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonamide (PubChem CID 86815657) has the molecular formula C14H14N4O3S and a molecular weight of 318.36 g/mol. Its IUPAC name is N-[(3-aminophenyl)methyl]-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonamide.
| Compound Name | N-[(3-aminophenyl)methyl]-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonamide |
|---|---|
| PubChem CID | 86815657 |
| Molecular Formula | C14H14N4O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-[(3-aminophenyl)methyl]-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonamide |
| SMILES | Cc1noc2ncc(S(=O)(=O)NCc3cccc(N)c3)cc12 |
| InChI | InChI=1S/C14H14N4O3S/c1-9-13-6-12(8-16-14(13)21-18-9)22(19,20)17-7-10-3-2-4-11(15)5-10/h2-6,8,17H,7,15H2,1H3 |
| InChIKey | XLOWHUMPPIAFGI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|