C20H20N4O3 — CID 128966066
[(3aS,6aS)-3a-(3-benzyl-1,2,4-oxadiazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(1,3-oxazol-4-yl)methanone (PubChem CID 128966066) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is [(3aS,6aS)-3a-(3-benzyl-1,2,4-oxadiazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(1,3-oxazol-4-yl)methanone.
| Compound Name | [(3aS,6aS)-3a-(3-benzyl-1,2,4-oxadiazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(1,3-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 128966066 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [(3aS,6aS)-3a-(3-benzyl-1,2,4-oxadiazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(1,3-oxazol-4-yl)methanone |
| SMILES | O=C(c1cocn1)N1C[C@H]2CCC[C@@]2(c2nc(Cc3ccccc3)no2)C1 |
| InChI | InChI=1S/C20H20N4O3/c25-18(16-11-26-13-21-16)24-10-15-7-4-8-20(15,12-24)19-22-17(23-27-19)9-14-5-2-1-3-6-14/h1-3,5-6,11,13,15H,4,7-10,12H2/t15-,20-/m1/s1 |
| InChIKey | KDFYEYWIUVYOLD-FOIQADDNSA-N |
| XLogP | 2.84 |
| TPSA | 85.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |