C21H27N3O3 — CID 128967221
5-[(3aS,6aS)-2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]-3-benzyl-1,2,4-oxadiazole (PubChem CID 128967221) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 5-[(3aS,6aS)-2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]-3-benzyl-1,2,4-oxadiazole.
| Compound Name | 5-[(3aS,6aS)-2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]-3-benzyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 128967221 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 5-[(3aS,6aS)-2-[2-(1,3-dioxolan-2-yl)ethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]-3-benzyl-1,2,4-oxadiazole |
| SMILES | c1ccc(Cc2noc([C@@]34CCC[C@@H]3CN(CCC3OCCO3)C4)n2)cc1 |
| InChI | InChI=1S/C21H27N3O3/c1-2-5-16(6-3-1)13-18-22-20(27-23-18)21-9-4-7-17(21)14-24(15-21)10-8-19-25-11-12-26-19/h1-3,5-6,17,19H,4,7-15H2/t17-,21-/m1/s1 |
| InChIKey | REHDNIALAKUWNK-DYESRHJHSA-N |
| XLogP | 2.78 |
| TPSA | 60.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |