C23H30N4O2 — CID 128968570
2-[(3aS,6aS)-3a-[3-(cyclopropylmethyl)-1,2,4-oxadiazol-5-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 128968570) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-[(3aS,6aS)-3a-[3-(cyclopropylmethyl)-1,2,4-oxadiazol-5-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[(3aS,6aS)-3a-[3-(cyclopropylmethyl)-1,2,4-oxadiazol-5-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 128968570 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 2-[(3aS,6aS)-3a-[3-(cyclopropylmethyl)-1,2,4-oxadiazol-5-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN1C[C@H]2CCC[C@@]2(c2nc(CC3CC3)no2)C1 |
| InChI | InChI=1S/C23H30N4O2/c1-15-5-3-6-16(2)21(15)25-20(28)13-27-12-18-7-4-10-23(18,14-27)22-24-19(26-29-22)11-17-8-9-17/h3,5-6,17-18H,4,7-14H2,1-2H3,(H,25,28)/t18-,23-/m1/s1 |
| InChIKey | VVIFQLIXDDCASW-WZONZLPQSA-N |
| XLogP | 3.63 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |