C22H26N4O2 — CID 128968873
(E)-1-[(3aS,6aS)-3a-[3-(cyclopropylmethyl)-1,2,4-oxadiazol-5-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(4-methyl-3-pyridinyl)prop-2-en-1-one (PubChem CID 128968873) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is (E)-1-[(3aS,6aS)-3a-[3-(cyclopropylmethyl)-1,2,4-oxadiazol-5-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(4-methyl-3-pyridinyl)prop-2-en-1-one.
| Compound Name | (E)-1-[(3aS,6aS)-3a-[3-(cyclopropylmethyl)-1,2,4-oxadiazol-5-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(4-methyl-3-pyridinyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 128968873 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | (E)-1-[(3aS,6aS)-3a-[3-(cyclopropylmethyl)-1,2,4-oxadiazol-5-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(4-methyl-3-pyridinyl)prop-2-en-1-one |
| SMILES | Cc1ccncc1/C=C/C(=O)N1C[C@H]2CCC[C@@]2(c2nc(CC3CC3)no2)C1 |
| InChI | InChI=1S/C22H26N4O2/c1-15-8-10-23-12-17(15)6-7-20(27)26-13-18-3-2-9-22(18,14-26)21-24-19(25-28-21)11-16-4-5-16/h6-8,10,12,16,18H,2-5,9,11,13-14H2,1H3/b7-6+/t18-,22-/m1/s1 |
| InChIKey | DEJZIWZJIIJDEO-VWOJUMNXSA-N |
| XLogP | 3.32 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|