C18H23N5O3 — CID 128968480
1-methyl-3-[[4-(2-pyridin-3-ylpropanoyl)morpholin-2-yl]methylamino]pyrazin-2-one (PubChem CID 128968480) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-methyl-3-[[4-(2-pyridin-3-ylpropanoyl)morpholin-2-yl]methylamino]pyrazin-2-one.
| Compound Name | 1-methyl-3-[[4-(2-pyridin-3-ylpropanoyl)morpholin-2-yl]methylamino]pyrazin-2-one |
|---|---|
| PubChem CID | 128968480 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 1-methyl-3-[[4-(2-pyridin-3-ylpropanoyl)morpholin-2-yl]methylamino]pyrazin-2-one |
| SMILES | CC(C(=O)N1CCOC(CNc2nccn(C)c2=O)C1)c1cccnc1 |
| InChI | InChI=1S/C18H23N5O3/c1-13(14-4-3-5-19-10-14)17(24)23-8-9-26-15(12-23)11-21-16-18(25)22(2)7-6-20-16/h3-7,10,13,15H,8-9,11-12H2,1-2H3,(H,20,21) |
| InChIKey | AMGXTBFVRUCFEL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |