C17H24N6O3 — CID 129002643
1-methyl-3-[[4-(1-propylpyrazole-4-carbonyl)morpholin-2-yl]methylamino]pyrazin-2-one (PubChem CID 129002643) has the molecular formula C17H24N6O3 and a molecular weight of 360.42 g/mol. Its IUPAC name is 1-methyl-3-[[4-(1-propylpyrazole-4-carbonyl)morpholin-2-yl]methylamino]pyrazin-2-one.
| Compound Name | 1-methyl-3-[[4-(1-propylpyrazole-4-carbonyl)morpholin-2-yl]methylamino]pyrazin-2-one |
|---|---|
| PubChem CID | 129002643 |
| Molecular Formula | C17H24N6O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 1-methyl-3-[[4-(1-propylpyrazole-4-carbonyl)morpholin-2-yl]methylamino]pyrazin-2-one |
| SMILES | CCCn1cc(C(=O)N2CCOC(CNc3nccn(C)c3=O)C2)cn1 |
| InChI | InChI=1S/C17H24N6O3/c1-3-5-23-11-13(9-20-23)16(24)22-7-8-26-14(12-22)10-19-15-17(25)21(2)6-4-18-15/h4,6,9,11,14H,3,5,7-8,10,12H2,1-2H3,(H,18,19) |
| InChIKey | RENAMRXYOPQYHU-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |