C18H21N3O2 — CID 128971899
(2R,3S)-N-(1-benzofuran-3-ylmethyl)-2-(1-methylpyrazol-4-yl)oxan-3-amine (PubChem CID 128971899) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is (2R,3S)-N-(1-benzofuran-3-ylmethyl)-2-(1-methylpyrazol-4-yl)oxan-3-amine.
| Compound Name | (2R,3S)-N-(1-benzofuran-3-ylmethyl)-2-(1-methylpyrazol-4-yl)oxan-3-amine |
|---|---|
| PubChem CID | 128971899 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (2R,3S)-N-(1-benzofuran-3-ylmethyl)-2-(1-methylpyrazol-4-yl)oxan-3-amine |
| SMILES | Cn1cc([C@H]2OCCC[C@@H]2NCc2coc3ccccc23)cn1 |
| InChI | InChI=1S/C18H21N3O2/c1-21-11-13(10-20-21)18-16(6-4-8-22-18)19-9-14-12-23-17-7-3-2-5-15(14)17/h2-3,5,7,10-12,16,18-19H,4,6,8-9H2,1H3/t16-,18+/m0/s1 |
| InChIKey | AOMGJHLDZOTQGK-FUHWJXTLSA-N |
| XLogP | 3.18 |
| TPSA | 52.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |