C21H21ClN4O3 — CID 128973049
(2S,3S)-N-[(6-chloro-3-pyridinyl)methyl]-2-[2-(2-methoxyphenyl)pyrazol-3-yl]oxolane-3-carboxamide (PubChem CID 128973049) has the molecular formula C21H21ClN4O3 and a molecular weight of 412.88 g/mol. Its IUPAC name is (2S,3S)-N-[(6-chloro-3-pyridinyl)methyl]-2-[2-(2-methoxyphenyl)pyrazol-3-yl]oxolane-3-carboxamide.
| Compound Name | (2S,3S)-N-[(6-chloro-3-pyridinyl)methyl]-2-[2-(2-methoxyphenyl)pyrazol-3-yl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 128973049 |
| Molecular Formula | C21H21ClN4O3 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (2S,3S)-N-[(6-chloro-3-pyridinyl)methyl]-2-[2-(2-methoxyphenyl)pyrazol-3-yl]oxolane-3-carboxamide |
| SMILES | COc1ccccc1-n1nccc1[C@H]1OCC[C@@H]1C(=O)NCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C21H21ClN4O3/c1-28-18-5-3-2-4-16(18)26-17(8-10-25-26)20-15(9-11-29-20)21(27)24-13-14-6-7-19(22)23-12-14/h2-8,10,12,15,20H,9,11,13H2,1H3,(H,24,27)/t15-,20-/m0/s1 |
| InChIKey | CCVJNCOPNIDGIN-YWZLYKJASA-N |
| XLogP | 3.32 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|