C20H26FN3O4 — CID 128974294
(2S,3S)-N-[(3-fluoro-4-methoxyphenyl)methyl]-2-[2-(3-methoxypropyl)pyrazol-3-yl]oxolane-3-carboxamide (PubChem CID 128974294) has the molecular formula C20H26FN3O4 and a molecular weight of 391.44 g/mol. Its IUPAC name is (2S,3S)-N-[(3-fluoro-4-methoxyphenyl)methyl]-2-[2-(3-methoxypropyl)pyrazol-3-yl]oxolane-3-carboxamide.
| Compound Name | (2S,3S)-N-[(3-fluoro-4-methoxyphenyl)methyl]-2-[2-(3-methoxypropyl)pyrazol-3-yl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 128974294 |
| Molecular Formula | C20H26FN3O4 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (2S,3S)-N-[(3-fluoro-4-methoxyphenyl)methyl]-2-[2-(3-methoxypropyl)pyrazol-3-yl]oxolane-3-carboxamide |
| SMILES | COCCCn1nccc1[C@H]1OCC[C@@H]1C(=O)NCc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C20H26FN3O4/c1-26-10-3-9-24-17(6-8-23-24)19-15(7-11-28-19)20(25)22-13-14-4-5-18(27-2)16(21)12-14/h4-6,8,12,15,19H,3,7,9-11,13H2,1-2H3,(H,22,25)/t15-,19-/m0/s1 |
| InChIKey | WWTKQVYZWUDZIY-KXBFYZLASA-N |
| XLogP | 2.46 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|