C16H20FN3O3S — CID 128975568
3-fluoro-N-[(1-methylimidazol-2-yl)-(oxan-4-yl)methyl]benzenesulfonamide (PubChem CID 128975568) has the molecular formula C16H20FN3O3S and a molecular weight of 353.42 g/mol. Its IUPAC name is 3-fluoro-N-[(1-methylimidazol-2-yl)-(oxan-4-yl)methyl]benzenesulfonamide.
| Compound Name | 3-fluoro-N-[(1-methylimidazol-2-yl)-(oxan-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 128975568 |
| Molecular Formula | C16H20FN3O3S |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 3-fluoro-N-[(1-methylimidazol-2-yl)-(oxan-4-yl)methyl]benzenesulfonamide |
| SMILES | Cn1ccnc1C(NS(=O)(=O)c1cccc(F)c1)C1CCOCC1 |
| InChI | InChI=1S/C16H20FN3O3S/c1-20-8-7-18-16(20)15(12-5-9-23-10-6-12)19-24(21,22)14-4-2-3-13(17)11-14/h2-4,7-8,11-12,15,19H,5-6,9-10H2,1H3 |
| InChIKey | MXKCHLINPMHDAG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |