C18H15F4N3O2S — CID 24541159
N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 24541159) has the molecular formula C18H15F4N3O2S and a molecular weight of 413.40 g/mol. Its IUPAC name is N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 24541159 |
| Molecular Formula | C18H15F4N3O2S |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cn1ccnc1C(NS(=O)(=O)c1cccc(C(F)(F)F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C18H15F4N3O2S/c1-25-9-8-23-17(25)16(12-4-2-6-14(19)10-12)24-28(26,27)15-7-3-5-13(11-15)18(20,21)22/h2-11,16,24H,1H3 |
| InChIKey | CLAYVDDXPSUQBU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |