About 2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine
2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine (PubChem CID 128978294) has the molecular formula C12H16F3N3O2
and a molecular weight of 291.27 g/mol. Its IUPAC name is 2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | 2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine |
| PubChem CID | 128978294 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine |
| SMILES | COC[C@@H]1C[C@H](OC)CN1c1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H16F3N3O2/c1-19-7-8-5-9(20-2)6-18(8)11-16-4-3-10(17-11)12(13,14)15/h3-4,8-9H,5-7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | RGTVUVGHHJFMOG-IUCAKERBSA-N |
| XLogP | 1.74 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine?
The IUPAC name of 2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine (CID 128978294) is 2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine.
What is the SMILES notation for 2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine?
The canonical SMILES for 2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine is COC[C@@H]1C[C@H](OC)CN1c1nccc(C(F)(F)F)n1.
What is the InChIKey of 2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine?
The InChIKey is RGTVUVGHHJFMOG-IUCAKERBSA-N. The full InChI is InChI=1S/C12H16F3N3O2/c1-19-7-8-5-9(20-2)6-18(8)11-16-4-3-10(17-11)12(13,14)15/h3-4,8-9H,5-7H2,1-2H3/t8-,9-/m0/s1.
What are the key properties of 2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine?
2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine has a molecular weight of 291.27 g/mol, XLogP of 1.74, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 128978294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).