C15H20FN5O — CID 128979367
N-[(1-ethylimidazol-2-yl)-(oxan-4-yl)methyl]-5-fluoropyrimidin-2-amine (PubChem CID 128979367) has the molecular formula C15H20FN5O and a molecular weight of 305.36 g/mol. Its IUPAC name is N-[(1-ethylimidazol-2-yl)-(oxan-4-yl)methyl]-5-fluoropyrimidin-2-amine.
| Compound Name | N-[(1-ethylimidazol-2-yl)-(oxan-4-yl)methyl]-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 128979367 |
| Molecular Formula | C15H20FN5O |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | N-[(1-ethylimidazol-2-yl)-(oxan-4-yl)methyl]-5-fluoropyrimidin-2-amine |
| SMILES | CCn1ccnc1C(Nc1ncc(F)cn1)C1CCOCC1 |
| InChI | InChI=1S/C15H20FN5O/c1-2-21-6-5-17-14(21)13(11-3-7-22-8-4-11)20-15-18-9-12(16)10-19-15/h5-6,9-11,13H,2-4,7-8H2,1H3,(H,18,19,20) |
| InChIKey | IQBSQSONFJZGHD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |