C17H24FN5O — CID 128979366
6-ethyl-N-[(1-ethylimidazol-2-yl)-(oxan-4-yl)methyl]-5-fluoropyrimidin-4-amine (PubChem CID 128979366) has the molecular formula C17H24FN5O and a molecular weight of 333.41 g/mol. Its IUPAC name is 6-ethyl-N-[(1-ethylimidazol-2-yl)-(oxan-4-yl)methyl]-5-fluoropyrimidin-4-amine.
| Compound Name | 6-ethyl-N-[(1-ethylimidazol-2-yl)-(oxan-4-yl)methyl]-5-fluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 128979366 |
| Molecular Formula | C17H24FN5O |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 6-ethyl-N-[(1-ethylimidazol-2-yl)-(oxan-4-yl)methyl]-5-fluoropyrimidin-4-amine |
| SMILES | CCc1ncnc(NC(c2nccn2CC)C2CCOCC2)c1F |
| InChI | InChI=1S/C17H24FN5O/c1-3-13-14(18)16(21-11-20-13)22-15(12-5-9-24-10-6-12)17-19-7-8-23(17)4-2/h7-8,11-12,15H,3-6,9-10H2,1-2H3,(H,20,21,22) |
| InChIKey | RGBGHVAKQCGEIE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |