C17H23FN6O — CID 129007467
1-ethyl-3-[4-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]piperidin-1-yl]pyrazin-2-one (PubChem CID 129007467) has the molecular formula C17H23FN6O and a molecular weight of 346.41 g/mol. Its IUPAC name is 1-ethyl-3-[4-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]piperidin-1-yl]pyrazin-2-one.
| Compound Name | 1-ethyl-3-[4-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]piperidin-1-yl]pyrazin-2-one |
|---|---|
| PubChem CID | 129007467 |
| Molecular Formula | C17H23FN6O |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-ethyl-3-[4-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]piperidin-1-yl]pyrazin-2-one |
| SMILES | CCc1ncnc(NC2CCN(c3nccn(CC)c3=O)CC2)c1F |
| InChI | InChI=1S/C17H23FN6O/c1-3-13-14(18)15(21-11-20-13)22-12-5-8-24(9-6-12)16-17(25)23(4-2)10-7-19-16/h7,10-12H,3-6,8-9H2,1-2H3,(H,20,21,22) |
| InChIKey | NGIDQTCSMNQYOB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |